Topics
>
Statistics and Probability>
Probability>
Probability Tree (Independent Events)>
Probability Tree (Independent) 1Probability Tree (Independent) 1
Try VividMath Premium to unlock full access
Time limit: 0
Quiz summary
0 of 5 questions completed
Questions:
- 1
- 2
- 3
- 4
- 5
Information
–
You have already completed the quiz before. Hence you can not start it again.
Quiz is loading...
You must sign in or sign up to start the quiz.
You have to finish following quiz, to start this quiz:
Loading...
- 1
- 2
- 3
- 4
- 5
- Answered
- Review
-
Question 1 of 5
1. Question
Find the probability of tossing a normal coin twice and getting:`(a) 2` Tails`(b)` Heads and Tails (in any order)Write fractions in the format “a/b”-
`(a)` (¼, 1/4)`(b)` (½, 1/2, 2/4)
Hint
Help VideoCorrect
Well Done!
Incorrect
Probability Formula
$$\mathsf{P(E)}=\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$Addition Rule
$$\mathsf{P(A\:or\:B)}=\mathsf{P(A)}+\mathsf{P(B)}$$Product Rule
$$\mathsf{P(A\:and\:B)}=\mathsf{P(A)}\times\mathsf{P(B)}$$`(a)` Find the probability of getting `2` Tails.First, set up a probability tree showing all possible outcomes of tossing a coin twice
Find the probability of all outcomes$$ \mathsf{P(Heads)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Heads out of `2` sides $$ \mathsf{P(Tails)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Tails out of `2` sides Mark each outcome with its corresponding probability
Finally, solve for the probability by picking the branch that leads to `2` Tails and multiplying the probabilities along it
`1/2``times``1/2` `=` `1/4` Product Rule Therefore, the probability of throwing Tails twice is `1/4``(b)` Find the probability of getting Heads and Tails.Use the probability tree from part `(a)` and pick the branches that lead to Heads and Tails then multiply the probabilities along it
First branch (HT):`1/2``times``1/2` `=` `1/4` Product Rule Second branch (TH):`1/2``times``1/2` `=` `1/4` Product Rule Finally, add the solved probability for each branch`1/4``+``1/4` `=` `2/4` `=` `1/2` Addition Rule Therefore, the probability of getting Heads and Tails is `1/2``(a) 1/4``(b) 1/2` -
-
Question 2 of 5
2. Question
A spinner is spun twice. Find the probability of the spinner landing on Blue at least once
Write fractions in the format “a/b”- (5/9)
Hint
Help VideoCorrect
Correct!
Incorrect
Probability Formula
$$\mathsf{P(E)}=\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$Complementary
Probability$$\mathsf{P(\dot{E})}=1-\mathsf{P(E)}$$Addition Rule
$$\mathsf{P(A\:or\:B)}=\mathsf{P(A)}+\mathsf{P(B)}$$Product Rule
$$\mathsf{P(A\:and\:B)}=\mathsf{P(A)}\times\mathsf{P(B)}$$First, set up a probability tree showing all possible outcomes of the spinner landing on Blue at least once
A circle represents `360°`. From the diagram, we can see the probability of landing on Pink is `60/360`.We can also see Green represents half the circle`.: \text(Green)=180/360`To find the probability of landing on Blue, simply subtract the probability of landing on Green `color(forestgreen)((180))` and Pink `color(pink)((60))` from `360`.`\text(Blue)=360-(color(forestgreen)(180)+color(pink)(60))=120``:. \text(Blue)=120/360`Mark each outcome with its corresponding probability
Note in a probability tree event, the fractions when added must equal `1``1/6+1/2+1/3=1/1=1`Finally, pick the branches that lead to outcomes where the spinner lands on Blue at least once
`P(PB)+P(GB)+P(BP)+P(BG)+P(BB)``=` `(1/6xx1/3)+(1/2xx1/3)+(1/3xx1/6)+(1/3xx1/2)+(1/3xx1/3)` `=` `1/18+1/6+1/18+1/6+1/9` `=` `5/9` Therefore, the probability of the spinner landing on Blue at least once is `5/9``5/9` -
Question 3 of 5
3. Question
Find the probability of tossing a normal coin thrice and getting:`(a)` Heads, Tails, Tails (in that order)`(b) 2` Tails and Heads (in any order)Write fractions in the format “a/b”-
`(a)` (⅛, 1/8)`(b)` (⅜, 3/8)
Hint
Help VideoCorrect
Nice Job!
Incorrect
Probability Formula
$$\mathsf{P(E)}=\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$Addition Rule
$$\mathsf{P(A\:or\:B)}=\mathsf{P(A)}+\mathsf{P(B)}$$Product Rule
$$\mathsf{P(A\:and\:B)}=\mathsf{P(A)}\times\mathsf{P(B)}$$`(a)` Find the probability of getting Heads, Tails, Tails.First, set up a probability tree showing all possible outcomes of tossing a coin thrice
Find the probability of all outcomes$$ \mathsf{P(Heads)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Heads out of `2` sides $$ \mathsf{P(Tails)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Tails out of `2` sides Mark each outcome with its corresponding probability
Finally, solve for the probability by picking the branch that leads to Heads, Tails, Tails and multiplying the probabilities along it
`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Therefore, the probability of throwing Heads, Tails, Tails twice in that order is `1/8``(b)` Find the probability of getting `2` Tails and `1` Heads.Use the probability tree from part `(a)` and pick the branches that lead to `2` Tails and `1` Heads then multiply the probabilities along it
First branch (HTT):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Second branch (THT):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Third branch (TTH):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Finally, add the solved probability for each branch`1/8``+``1/8``+``1/8` `=` `3/8` Addition Rule Therefore, the probability of getting `2` Tails and `1` Heads is `3/8``(a) 1/8``(b) 3/8` -
-
Question 4 of 5
4. Question
Find the probability of tossing a normal coin thrice and getting:`(a) 3` of a kind`(b)` at least `2` HeadsWrite fractions in the format “a/b”-
`(a)` (¼, 1/4, 2/8)`(b)` (½, 1/2, 4/8)
Hint
Help VideoCorrect
Excellent!
Incorrect
Probability Formula
$$\mathsf{P(E)}=\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$Addition Rule
$$\mathsf{P(A\:or\:B)}=\mathsf{P(A)}+\mathsf{P(B)}$$Product Rule
$$\mathsf{P(A\:and\:B)}=\mathsf{P(A)}\times\mathsf{P(B)}$$`(a)` Find the probability of getting `3` of a kind.First, set up a probability tree showing all possible outcomes of tossing a coin thrice
Find the probability of all outcomes$$ \mathsf{P(Heads)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Heads out of `2` sides $$ \mathsf{P(Tails)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Tails out of `2` sides Mark each outcome with its corresponding probability
Pick the branches that lead to `3` of a kind then multiply the probabilities along it
First branch (HHH):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Second branch (TTT):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Finally, add the solved probability for each branch`1/8``+``1/8` `=` `2/8` `=` `1/4` Addition Rule Therefore, the probability of getting `3` of a kind is `1/4``(b)` Find the probability of getting at least `2` Heads.Use the probability tree from part `(a)` and pick the branches that lead to at least `2` Heads then multiply the probabilities along it
First branch (HHT):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Second branch (HTH):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Third branch (HHT):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Fourth branch (HHH):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Finally, add the solved probability for each branch`1/8``+``1/8``+``1/8``+``1/8` `=` `4/8` `=` `1/2` Addition Rule Therefore, the probability of getting at least `2` Heads is `1/2``(a) 1/4``(b) 1/2` -
-
Question 5 of 5
5. Question
Find the probability of tossing a normal coin thrice and getting `3` Heads or Heads, Tails, Heads in that order.Write fractions in the format “a/b”- (¼, 1/4, 2/8)
Hint
Help VideoCorrect
Fantastic!
Incorrect
Probability Formula
$$\mathsf{P(E)}=\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$Addition Rule
$$\mathsf{P(A\:or\:B)}=\mathsf{P(A)}+\mathsf{P(B)}$$Product Rule
$$\mathsf{P(A\:and\:B)}=\mathsf{P(A)}\times\mathsf{P(B)}$$First, set up a probability tree showing all possible outcomes of tossing a coin thrice
Find the probability of all outcomes$$ \mathsf{P(Heads)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Heads out of `2` sides $$ \mathsf{P(Tails)} $$ `=` $$\frac{\color{#e65021}{\mathsf{favourable\:outcomes}}}{\color{#007DDC}{\mathsf{total\:outcomes}}}$$ Probability Formula `=` $$\frac{\color{#e65021}{1}}{\color{#007DDC}{2}}$$ `1` Tails out of `2` sides Mark each outcome with its corresponding probability
Pick the branches that lead to the preferred outcomes then multiply the probabilities along it
First branch (HHH):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Second branch (HTH):`1/2``times``1/2``times``1/2` `=` `1/8` Product Rule Finally, add the solved probability for each branch`1/8``+``1/8` `=` `2/8` `=` `1/4` Addition Rule Therefore, the probability of getting `3` Heads and Heads, Tails, Heads is `1/4``1/4`
Quizzes
- Simple Probability 1
- Simple Probability 2
- Simple Probability 3
- Simple Probability 4
- Complementary Probability 1
- Compound Events 1
- Compound Events 2
- Venn Diagrams (Non Mutually Exclusive)
- Independent Events 1
- Independent Events 2
- Dependent Events (Conditional Probability)
- Probability Tree (Independent) 1
- Probability Tree (Independent) 2
- Probability Tree (Dependent)